ChemNet > CAS > 121-32-4 3-Ethoxy-4-hydroxybenzaldehyde
121-32-4 3-Ethoxy-4-hydroxybenzaldehyde
| product Name |
3-Ethoxy-4-hydroxybenzaldehyde |
| CAS No |
121-32-4 |
| Synonyms |
Ethyl vanillin; protocatechualdehyde ethyl ether; Bourbonal; Ethyl protal; Ethyl protocatechualdehyde 3-ethyl ether; 3-Ethoxy-4-hydroxy-benzaldehyde |
| Molecular Formula |
C9H10O3 |
| Molecular Weight |
166.1739 |
| InChI |
InChI=1/C9H10O3/c1-2-12-9-5-7(6-10)3-4-8(9)11/h3-6,11H,2H2,1H3 |
| EINECS |
204-464-7 |
| Molecular Structure |
|
| Density |
1.186g/cm3 |
| Melting point |
76-79℃ |
| Boiling point |
295.1°C at 760 mmHg |
| Refractive index |
1.573 |
| Flash point |
119°C |
| Water solubility |
slightly soluble |
| Vapour Pressur |
0.000884mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
R36/37/38:;
|
| Safety Description |
S26:;
S36:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Packing |
25kgs net drum |
| Description |
Molecular Formula: C9H10O3 Molecular Weight: 166.17 CAS Number: 121-32-4EG/EC Number: 2044647MDL Number: MFCD00006944 |
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |
| Packing |
25kg/Drum |
| Description |
Ethyl vanillin is a synthetic spice commonly used in industries such as food, beverages, cosmetics, and detergents. It has a strong vanilla aroma, which can enhance the flavor and taste of the product. In addition, ethyl vanillin also has good antioxidant properties and can be used to protect products from oxidative damage. Application: 1. Food industry: Ethyl vanillin is widely used in the food industry, such as pastries, beverages, candies, condiments, etc., to increase product aroma and improve taste. 2. Cosmetics industry: Ethyl vanillin can be used in cosmetics, such as perfume, skin care products, shampoo, etc., to provide vanilla fragrance and improve the smell of products. 3. Detergent industry: Ethylvanillin can be used in detergents such as soap, laundry detergent, etc., to increase product aroma and improve user experience. 4. Pharmaceutical field: Ethylvanillin can be used in pharmaceuticals as a fragrance additive to improve the acceptability of drugs. 5. Feed additive... |
| Contact |
Mr.Guo |
| Telephone |
+86-570-3080488;3082488;3080881 |
| Email |
sx@shengxiaochemical.com |
| Address |
Shengxiao Building, Block C, Building 30, Hehua East District, Quzhou, Zhejiang, China |
| Contact |
Mr. Yicheng Yu Mr. Jarod Yang |
| Telephone |
0086-23-88505933 88505975 |
| Email |
yuyicheng@vip.sina.com jarodyang@vip.sina.com |
| Address |
9/F.,Fortune Tower A No.2 Fortune Road,Yubei District,Chongqing ,China |
| Telephone |
+86-21-68769091 |
| Email |
info@tritonchemtech.com |
| Address |
Room 717, 7/F, Information Tower, 1403 Minsheng Road, Shanghai, 200135, China |
| Contact |
Jiang Biao |
| Telephone |
+86-25-83479682 |
| Email |
paul@3cchem.com |
| Address |
Room 2107, Li??ao Building, No.323, Zhongyang Road,Nanjing City, Jiangsu Province, China. |