ChemNet > CAS > 935-44-4 1-Phenyl-1-cyclopropancarbonitril
935-44-4 1-Phenyl-1-cyclopropancarbonitril
| Produkt-Name |
1-Phenyl-1-cyclopropancarbonitril |
| Synonyme |
1-Phenylcyclopropancarbonitril |
| Englischer Name |
1-Phenyl-1-cyclopropanecarbonitrile;1-Phenylcyclopropanecarbonitrile |
| Molekulare Formel |
C10H9N |
| Molecular Weight |
143.1852 |
| InChI |
InChI=1/C10H9N/c11-8-10(6-7-10)9-4-2-1-3-5-9/h1-5H,6-7H2 |
| CAS Registry Number |
935-44-4 |
| EINECS |
213-304-5 |
| Molecular Structure |
|
| Dichte |
1.09g/cm3 |
| Siedepunkt |
238.5°C at 760 mmHg |
| Brechungsindex |
1.571 |
| Flammpunkt |
99°C |
| Dampfdruck |
0.0422mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|