497-36-9 Endo-(±)-Norborneol
| Produkt-Name |
Endo-(±)-Norborneol |
| Synonyme |
; endo-(?-2-Norbornanol;( 1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol |
| Englischer Name |
endo-(±)-Norborneol; endo-(?-2-Norbornanol; (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol |
| Molekulare Formel |
C7H12O |
| Molecular Weight |
112.1696 |
| InChI |
InChI=1/C7H12O/c8-7-4-5-1-2-6(7)3-5/h5-8H,1-4H2/t5-,6+,7-/m0/s1 |
| CAS Registry Number |
497-36-9 |
| EINECS |
207-844-0 |
| Molecular Structure |
|
| Dichte |
1.098g/cm3 |
| Schmelzpunkt |
148-154℃ |
| Siedepunkt |
176.499°C at 760 mmHg |
| Brechungsindex |
1.537 |
| Flammpunkt |
74.376°C |
| Dampfdruck |
0.332mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|