Details for Ethyl-2-bromoisovalerate

Ethyl-2-bromoisovalerate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
609-12-1 |
| EC NO: |
210-178-3 |
| Molecular Formula: |
C7H13BrO2 |
| Molecular Weight: |
209.0809 |
| Specification: |
|
| InChI: |
InChI=1/C7H13BrO2/c1-4-10-7(9)6(8)5(2)3/h5-6H,4H2,1-3H3/t6-/m0/s1 |
| Synonyms: |
2-Bromoisovaleric acid ethyl ester;Ethyl 2-bromo-3-methylbutyrate;TIMTEC-BB SBB005789;2-bromo-3-methyl-butanoicaciethylester;2-Bromoisovatericacidethylester;alpha-Bromoisovaleric acid ethyl ester;Butyric acid, 2-bromo-3-methyl-, ethyl ester;Ethyl 2-bromo-3-methylbutanoate;2-BROMOISOVALERIANIC Bromoisovalerianic acid ethyl ester;ethyl (2R)-2-bromo-3-methylbutanoate;ethyl (2S)-2-bromo-3-methylbutanoate;Ethyl 2-Bromo Isovalerate;Ethyl-2-bromoisovalerate; |
| Molecular Structure: |
 |
if you are sourcing Ethyl-2-bromoisovalerate from United-States ,just feel free to inquire