Details for Diethyl Succinate

Diethyl Succinate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
123-25-1 |
| EC NO: |
204-612-0 |
| Molecular Formula: |
C8H14O4 |
| Molecular Weight: |
174.1944 |
| Specification: |
|
| InChI: |
InChI=1/C8H14O4/c1-3-11-7(9)5-6-8(10)12-4-2/h3-6H2,1-2H3 |
| Synonyms: |
Ethyl succinate;Succinic acid diethyl ester;Butanedioic acid diethyl ester;diethyl butanedioate;anhydrous diethyl succinate;anhydrous diethyl succinate; |
| Molecular Structure: |
 |
if you are sourcing Diethyl Succinate from United-States ,just feel free to inquire