Details for Beta Naphthol

Beta Naphthol
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
135-19-3 |
| EC NO: |
205-182-7 |
| Molecular Formula: |
C10H8O |
| Molecular Weight: |
144.1699 |
| Specification: |
|
| InChI: |
InChI=1/C10H8O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H |
| Synonyms: |
C.I. 37500;C.I. Azoic coupling component 1;C.I. Developer 5;betanaphthol;2-naftol;2-naftolo;2-naphtol;antioxygene bn;azogen developer a;azogendevelopera;azoiccouplingcomponent1;beta-monoxynaphthalene;2-hydroxynaphthalene;beta naphthol;beta-naphthol;b-naphtol;naphthalen-2-ol; |
| Molecular Structure: |
 |
if you are sourcing Beta Naphthol from South-Korea ,just feel free to inquire