| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
68603-42-9 |
| EC NO: |
271-657-0;263-163-9 |
| Molecular Formula: |
C13H13Cl8NO4 |
| Molecular Weight: |
530.87062 |
| Specification: |
|
| InChI: |
InChI=1/C8H6Cl2O3.C3Cl6O.C2H7N/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;4-2(5,6)1(10)3(7,8)9;1-3-2/h1-3H,4H2,(H,11,12);;3H,1-2H3 |
| Synonyms: |
Coco bis(2-hydroxyethyl)amine;Diethanolamine coconut fatty acid condensate;Diethanolamine N-coco alkyl derivs.;N,N-Bis(2-hydroxyethyl)(coconut oil alkyl)amine;N,N-Bis(hydroxyethyl)cocoamine;N,N-Bishydroxyethyl cocoamine;UNII-92005F972D;Ethanol, 2,2'-iminobis-, N-coco alkyl derivs.;Diethanolamine of coconut fatty acid;Cocamide Diethanolamine;Detergent 6501;Bis(2- Hydroxyethyl) Cocoalkyl amine;COCAMIDE DEA;Coco Diethanol Amide;Cocodiethanolamide; |
| Molecular Structure: |
 |