Details for Para Anisic Acid

Para Anisic Acid
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
100-09-4 |
| EC NO: |
202-818-5 |
| Molecular Formula: |
C8H8O3 |
| Molecular Weight: |
152.1473 |
| Specification: |
|
| InChI: |
InChI=1/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10) |
| Synonyms: |
4-Methoxybenzoic Acid;P-anisic acid crystalline;melting point standard P-anisic acid;para-anisic acid;P-methoxybenzoic acid;bis[2-[[(p-methoxyphenyl)methylhydrazono]methyl]-1,3,3-trimethyl-3H-indolium] carbonate;anisic acid;Benzoic acid, methoxy-;Methoxybenzoic acid;4-methoxybenzoate; |
| Molecular Structure: |
 |
if you are sourcing Para Anisic Acid from India ,just feel free to inquire