Details for 3-Aminophenol

3-Aminophenol
| Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
591-27-5 |
| EC NO: |
209-711-2 |
| Molecular Formula: |
C6H7NO |
| Molecular Weight: |
109.13 |
| Specification: |
|
| InChI: |
InChI=1/C6H7NO/c7-5-2-1-3-6(8)4-5/h1-4,8H,7H2 |
| Synonyms: |
C.I. 76545;C.I. Oxidation Base 7;3-Amino-1-hydroxybenzene;m-hydroxyaminobenzene;3-Hydroxyaniline;m-hydroxyphenylamine;basf ursol bg;fouramine eg;fourrine 65;fourrine eg;furro eg;futramine eg;nako teg;pelagal eg;renal eg;tetral eg;ursol eg;zoba eg;M-Aminophenol;m-amino phenol;Meta Aminophenol;Aminophenol, 3-; |
| Molecular Structure: |
 |
if you are sourcing 3-Aminophenol from China ,just feel free to inquire