Details for M-chloroperoxybenzoic acid

M-chloroperoxybenzoic acid
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
937-14-4 |
| EC NO: |
213-322-3 |
| Molecular Formula: |
C7H5ClO3 |
| Molecular Weight: |
172.57 |
| Specification: |
|
| InChI: |
InChI:1S/C7H5ClO3/c8-6-3-1-2-5(4-6)7(9)11-10/h1-4,10H |
| Synonyms: |
3-Chloroperbenzoic acid; m-Chloroperbenzoic acid;m-CPBA
;3-Chloroperoxybenzoic acid;MCPBA;3-chlorobenzenecarboperoxoic acid;M-CHLORO BENZOYL HYDROPEROXIDE;M-cholroperoxbenzoic acid;3-Chloroperoxy benzoic acid;M-choroperoxybenzoic acid; |
| Molecular Structure: |
 |
if you are sourcing M-chloroperoxybenzoic acid from China ,just feel free to inquire