2-Methyl-4-chlorophenoxyacetic acid Suppliers, 2-Methyl-4-chlorophenoxyacetic acid Manufacturers.
| Category: | Organic chemicals and Derivatives/Halogenated derivatives | |
| CAS NO: | 94-74-6 | |
| EC NO: | 202-360-6 | |
| Molecular Formula: | C9H9ClO3 | |
| Molecular Weight: | 200.62 | |
| Specification: | ||
| InChI: | InChI=1/C9H9ClO3/c1-6-4-7(10)2-3-8(6)13-5-9(11)12/h2-4H,5H2,1H3,(H,11,12) | |
| Synonyms: | 2,4-MCPA;Hedonal;Hedonal M;Herbicide M;Hormotuho;Kilsem;Krezone;Leuna M;Linormone;MCPA;MCPA Ester;MCP ester;Mephanac;Netazol;Phenoxylene plus;Rhomene;Rhonox;Selektonon M;Shamrox;Weedar Sodium MCPA;Vacate;Weedar;Weedar MCPA;Weedone;Weedone MCPA Ester;Weed-rhap;Zelan;Metaxon;4-Chloro-o-cresoxyacetic acid;(4-chloro-2-methylphenoxy)acetate;(4-Chloro-2-methylphenoxy)acetic acid;(4-chloro-o-toloxy)acetic acid;(4-Chloro-o-tolyloxy)acetic acid;Agroxon;Anicon kombi;Anicon m;BH MCPA;Dicopur-M;Dikotex;Bordermaster;Cekherbex;Chiptox;Chwastox;CMP acetate;Cornox-m;Ded-weed;Emcepan;Empal;FLUID 4;Hedapur M 52;Hedarex M;2-Methyl-4-chlorophenoxy acetic acid; | |
Packaging Details: 25kg/ Barrel
use
Agriculture used for plant growth stimuli, prevent such as tomato fruit from the fallen petal early, and formed the no child fruit, promote crop early maturity, accelerate rooting cuttings. Also used for herbicides.
Company: |
Loyal Gain International Enterprise Limited |
E-mail: |
chem@netsun.com |
Address: |
Room 1101, Unit 2, Haizheng Xinyuan Areas, Fangzi New Zone. Weifang City 261014, Shandong Province, P.R.China. |
Zip Code: |
261000 |