| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
106-43-4 |
| EC NO: |
203-397-0 |
| Molecular Formula: |
C7H7Cl |
| Molecular Weight: |
126.5835 |
| Specification: |
|
| InChI: |
InChI=1/C7H7Cl/c1-6-4-2-3-5-7(6)8/h2-5H,1H3 |
| Packing: |
200KG/drum |
Product description:
Synonyms:1-chloro-4-methylbenzene;4-Chloro-1-methyl-benzene; p-tolyl chloride; PCT; 4-chloro toluene; p-Chlorotoluene; 1-chloro-2-methylbenzene;4-Chlorotoluene;4-Chlorotoluene;4-Chlorotoluene
Molecular Formula:C7H7Cl |
| Uses: |
It can be applied in making of pharmacy, pesticide and dyestuff etc. |
| Synonyms: |
1-chloro-4-methylbenzene;4-Chloro-1-methyl-benzene;p-tolyl chloride;PCT;4-chloro toluene;p-Chlorotoluene;1-chloro-2-methylbenzene;Para chloro toluene; |
| Molecular Structure: |
 |