Details for Ethyl 3-ethoxyacrylate

Ethyl 3-ethoxyacrylate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
1001-26-9 |
| EC NO: |
|
| Molecular Formula: |
C7H12O3 |
| Molecular Weight: |
144.1684 |
| Specification: |
|
| InChI: |
InChI=1/C7H12O3/c1-3-9-6-5-7(8)10-4-2/h5-6H,3-4H2,1-2H3/b6-5+ |
| Synonyms: |
3-ETHOXYACRYLIC ACID ETHYL ESTER;3-EAE;ETHYL 3-ETHOXY-2-PROPENOATE;BETA-ETHOXYACRYLIC ACID ETHYL ESTER;ETHYL 3-ETHOXYACRYLATE STAB.;Ethoxyacrylic acid ethyl ester, 97%;á-ethoxyacrylic acid ethyl ester;Ethyl trans-3-ethoxyacrylate;Ethyl3-ethoxyacrylate;ethyl 3-ethoxyprop-2-enoate;ethyl (E)-3-ethoxyprop-2-enoate;ethyl (2E)-3-ethoxyacrylate; |
| Molecular Structure: |
 |
if you are sourcing Ethyl 3-ethoxyacrylate from China ,just feel free to inquire