Details for 4-Bromo-2-fluoroanisole

4-Bromo-2-fluoroanisole
| Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
| CAS NO: |
2357-52-0 |
| EC NO: |
219-096-2 |
| Molecular Formula: |
C7H6BrFO |
| Molecular Weight: |
205.03 |
| Specification: |
GC≥99.5% |
| InChI: |
InChI=1/C7H6BrFO/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,1H3 |
| Packing: |
PTFE barrel or on request |
Product description:
Chemical Name: 4-Bromo-2-fluoroanisole
CAS No. 2357-52-0
Content: GC≥99.5%
Appearance: Colorless transparent liquid ;
Packing: PTFE barrel or on request;
Productivity: 10 Tons/M
|
| Uses: |
liquid crystal intermediates |
| Synonyms: |
2-fluoro-4-bromoanisole;1-BROMO-3-FLUORO-4-METHOXYBENZENE;4-bromo-2-fluoro-1-methoxybenzene; |
| Molecular Structure: |
 |
if you are sourcing 4-Bromo-2-fluoroanisole from China ,just feel free to inquire