Details for Transparent Red GS

Transparent Red GS
| Category: |
Dyestuffs and Pigments |
|
| CAS NO: |
82-38-2 |
| EC NO: |
201-417-2 |
| Molecular Formula: |
C15H11NO2 |
| Molecular Weight: |
237.2533 |
| Specification: |
|
| InChI: |
InChI=1/C15H11NO2/c1-16-12-8-4-7-11-13(12)15(18)10-6-3-2-5-9(10)14(11)17/h2-8,16H,1H3 |
| Synonyms: |
C.I. 60505;C.I. Disperse Red 9;C.I. Solvent Red 111;Disperse red 9;Solvent Red 111;Transparent Red GS;C.I.Solvent Red 111;1-Methylamino anthraquinone;Red GS;1-(methylamino)anthracene-9,10-dione;Plast red 3002;1-Methylaminoanthraquinone;Solvent Red 2R;1-Methylamino AQ/Disperse Red 9#;1-Methylamino AQ;Disperse Red 9#; |
| Molecular Structure: |
 |
if you are sourcing Transparent Red GS from China ,just feel free to inquire