| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
544-63-8 |
| EC NO: |
208-875-2 |
| Molecular Formula: |
C14H28O2 |
| Molecular Weight: |
228.37 |
| Specification: |
|
| InChI: |
InChI=1/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16) |
Product description:
White, colorless or faintly yellow crystalline solid or powder.In soaps & perfumes, in synthesis of esters for flavorings & perfumes, & a component of food-grade additives. |
| Synonyms: |
Tetradecanoic acid;myristic acid, pure;Myristic acid = n-Tetradecanoic Acid;Myristinsaeure;Tetradecanoicn acid; |
| Molecular Structure: |
 |