Details for Disperse Red 11

Disperse Red 11
| Category: |
Dyestuffs and Pigments |
|
| CAS NO: |
2872-48-2 |
| EC NO: |
220-703-8 |
| Molecular Formula: |
C15H12N2O3 |
| Molecular Weight: |
268.2674 |
| Specification: |
|
| InChI: |
InChI=1/C15H12N2O3/c1-20-10-6-9(16)11-12(13(10)17)15(19)8-5-3-2-4-7(8)14(11)18/h2-6H,16-17H2,1H3 |
| Synonyms: |
C.I. 62015;C.I. 11/52015;C.I. Disperse Red 11;C.I. Solvent Violet 26;CI 62015;1,4-diamino-2-methoxyanthracene-9,10-dione; |
| Molecular Structure: |
 |
if you are sourcing Disperse Red 11 from China ,just feel free to inquire