Details for Pyruvic aldehyde dimethyl acetal

Pyruvic aldehyde dimethyl acetal
| Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
6342-56-9 |
| EC NO: |
228-735-4 |
| Molecular Formula: |
C5H10O3 |
| Molecular Weight: |
118.1311 |
| Specification: |
|
| InChI: |
InChI=1/C5H10O3/c1-4(6)5(7-2)8-3/h5H,1-3H3 |
| Synonyms: |
Methylglyoxal dimethyl acetal~Pyruvaldehyde dimethyl acetal;Pyruvaldehyde dimethyl acetal;1,1-Dimethoxyacetone;1,1-dimethoxypropan-2-one;Methylglyoxal 1,1-dimethyl acetal; |
| Molecular Structure: |
 |
if you are sourcing Pyruvic aldehyde dimethyl acetal from China ,just feel free to inquire