Details for Ethyl Oleate

Ethyl Oleate
| Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
111-62-6 |
| EC NO: |
203-889-5 |
| Molecular Formula: |
C20H38O2 |
| Molecular Weight: |
310.5145 |
| Specification: |
|
| InChI: |
InChI=1/C20H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h11-12H,3-10,13-19H2,1-2H3/b12-11+ |
| Synonyms: |
9-Octadecenoic acid (Z)-, ethyl ester;Ethyl oleate, mixture of isomers; ;ethyl octadec-9-enoate;ethyl (9Z)-octadec-9-enoate;ethyl (9E)-octadec-9-enoate; |
| Molecular Structure: |
 |
if you are sourcing Ethyl Oleate from China ,just feel free to inquire