Details for Isoamyl nitrite

Isoamyl nitrite
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
110-46-3 |
| EC NO: |
203-770-8 |
| Molecular Formula: |
C9H9NO2 |
| Molecular Weight: |
163.1733 |
| Specification: |
|
| InChI: |
InChI=1/C9H9NO2/c1-7(10-12)9(11)8-5-3-2-4-6-8/h2-6,12H,1H3/b10-7+ |
| Synonyms: |
amyl nitrite, mixed isomers;Amyl nitrite;Isopentyl itrite;3-Methylbutyl nitrite;Nitrous acid 3-methylbutyl ester;(2E)-2-(hydroxyimino)-1-phenylpropan-1-one;Iso-Amyl nitrite;Isoamyl nitrite; |
| Molecular Structure: |
 |
if you are sourcing Isoamyl nitrite from China ,just feel free to inquire