Details for D-Pyroglutamic acid ethyl ester

D-Pyroglutamic acid ethyl ester
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
68766-96-1 |
| EC NO: |
|
| Molecular Formula: |
C7H11NO3 |
| Molecular Weight: |
157.1671 |
| Specification: |
|
| InChI: |
InChI=1/C7H11NO3/c1-2-11-7(10)5-3-4-6(9)8-5/h5H,2-4H2,1H3,(H,8,9)/t5-/m1/s1 |
Product description:
Product Name D-Pyr-OEt
CAS No. 68766-96-1
Synonyms Ethyl D-(-)-pyroglutamate
Purity 98.0% min
Molecular Formula C7H11NO3
Molecular Weight 157.17
|
| Synonyms: |
D-(-)-Pyroglutamic acid ethyl ester;Ethyl (R)-(-)-2-pyrrolidone-5-carboxylate;ethyl 5-oxo-D-prolinate;Ethyl D-pyroglutamate;H-D-Pyr-OEt;D-Pyr-Oet;D-Pyroglutamic acid ethyl ester; |
| Molecular Structure: |
 |
if you are sourcing D-Pyroglutamic acid ethyl ester from China ,just feel free to inquire