Details for 3-Nitro-4-chlorobenzonitrile
3-Nitro-4-chlorobenzonitrile
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
939-80-0 |
| EC NO: |
213-364-2 |
| Molecular Formula: |
C7H3ClN2O2 |
| Molecular Weight: |
182.5639 |
| Specification: |
98% |
| InChI: |
InChI=1/C7H3ClN2O2/c8-6-2-1-5(4-9)3-7(6)10(11)12/h1-3H |
| Packing: |
25kg/drum |
| Uses: |
Intermediate of organic synthesis |
| Synonyms: |
4-chlor-3-nitrobenzonitrile;4-chloro-3-nitro-benzonitril;2-chloro-5-cyanonitrobenzene;3-Nitro-4-chlorobenzonitrile; |
| Molecular Structure: |
 |
if you are sourcing 3-Nitro-4-chlorobenzonitrile from China ,just feel free to inquire
CN
China Suppliers > sunmy > 
Search Product