Details for Dimethyl Glutarate

Dimethyl Glutarate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
1119-40-0 |
| EC NO: |
214-277-2 |
| Molecular Formula: |
C10H11NO |
| Molecular Weight: |
161.2004 |
| Specification: |
|
| InChI: |
InChI=1/C10H11NO/c1-7-8-5-6-11-9(8)3-4-10(7)12-2/h3-6,11H,1-2H3 |
| Synonyms: |
dbe-5 dibasic ester;Glutaric acid dimethyl ester;Pentanedioic acid dimethyl ester;DIMETHYLE GLUTARATE;DBE-2;dimethyl pentanedioate;dimethyl glutamate;5-methoxy-4-methyl-1H-indole; |
| Molecular Structure: |
 |
if you are sourcing Dimethyl Glutarate from China ,just feel free to inquire