| Category: |
Intermediates/Pharmaceutical intermediates |
|
| CAS NO: |
18549-40-1 |
| EC NO: |
242-420-9 |
| Molecular Formula: |
C9H16O6 |
| Molecular Weight: |
220.2197 |
| Specification: |
It is white, microcrystalline solid. Its melting point is 159~161℃. |
| InChI: |
InChI=1/C9H16O6/c1-9(2)14-7-5(12)6(4(11)3-10)13-8(7)15-9/h4-8,10-12H,3H2,1-2H3/t4-,5-,6+,7+,8+/m0/s1 |
| Packing: |
25kg/drum |
Product description:
Properties:? White crystalline powder. Dissolve in water, acetone, ethanol, tetrahydrofuran,dimethyl formamide etc.
Uses: This product is an important pharmaceutical intermediates. Used in synthesis nojirimycin and deoxynojirimycin for treatment diabetes, complexes that carbohydrate combine with organic metal including platinum, osmium tetroxide, ruthenium, etc for treatment cancer, other anticancer or antitumor pharmaceuticals and their precursor such as organic phosphide, and azole that contain glycosyl for resistance to junin virus and fever virus such as dengue fever, dengue hemorrhagic fever and Argentine hemorrhagic fever. |
| Synonyms: |
1,2-O-Isopropylidene-alpha-D-glucofuranose;1,2-O-(1-methylethylidene)-alpha-D-glucofuranose;1,2-O-(1-methylethylidene)hexofuranose;1,2-O-(1-methylethylidene)-β-L-idofuranose;Monoacetone-D-glucose; |
| Molecular Structure: |
 |