Details for Methyl thio acetate

Methyl thio acetate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
1534-08-3 |
| EC NO: |
216-252-1 |
| Molecular Formula: |
C3H7O2S |
| Molecular Weight: |
107.152 |
| Specification: |
|
| InChI: |
InChI=1/C2H4O2.CH4S/c1-2(3)4;1-2/h1H3,(H,3,4);2H,1H3/p-1 |
| Synonyms: |
Thioacetic acid S-methyl ester;S-methyl ethanethioate;methyl ethane(dithioate);(methylsulfanyl)acetate;Methyl thioacetate;Methanethiol acetate; |
| Molecular Structure: |
 |
if you are sourcing Methyl thio acetate from China ,just feel free to inquire