Details for Ethylthio acetate

Ethylthio acetate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
625-60-5 |
| EC NO: |
261-601-3;210-904-9 |
| Molecular Formula: |
C4H8OS |
| Molecular Weight: |
104.1707 |
| Specification: |
|
| InChI: |
InChI=1/C4H8OS/c1-3-6-4(2)5/h3H2,1-2H3 |
| Synonyms: |
Ethanethioic acid, ethyl ester;Acetic acid, thio-, ethyl ester;Ethyl ethanethioate;S-ethyl ethanethioate;S-Ethyl thioacetate;Thioacetic acid S-ethyl ester;O-ethyl ethanethioate;S-ethyl ethanethoate;S-ethylthioacetate;Ethanethioic Acid S-Ethyl Ester; |
| Molecular Structure: |
 |
if you are sourcing Ethylthio acetate from China ,just feel free to inquire