Details for Sodium Iso Propyl Xanthate

Sodium Iso Propyl Xanthate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
140-93-2 |
| EC NO: |
205-443-5 |
| Molecular Formula: |
C4H8NaOS2 |
| Molecular Weight: |
159.2249 |
| Specification: |
|
| InChI: |
InChI=1/C4H8OS2.Na/c1-3(2)5-4(6)7;/h3H,1-2H3,(H,6,7);/q;+1 |
| Synonyms: |
Proxan sodium;Sodium Isopropyl Xanthate;Sodium Isoproylxanthate;sodium O-propan-2-yl carbonodithioate;Isopropyl sodium xanthate;Sodium Iso-propyl Xanthate; |
| Molecular Structure: |
 |
if you are sourcing Sodium Iso Propyl Xanthate from China ,just feel free to inquire