Details for Amyl Acetate

Amyl Acetate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
628-63-7 |
| EC NO: |
211-047-3 |
| Molecular Formula: |
C7H14O2 |
| Molecular Weight: |
130.1849 |
| Specification: |
|
| InChI: |
InChI=1/C7H14O2/c1-3-4-5-6-9-7(2)8/h3-6H2,1-2H3 |
| Synonyms: |
n-Amyl acetate;Amyl Acetate (mixed isomers);Acetic acid n-pentyl ester;n-Amyl acetate;Acetic Acid n-Amyl Ester;pentyl acetate;Amyl acetate;Nitrocellulose lacquer thinner;Acetic ester; |
| Molecular Structure: |
 |
if you are sourcing Amyl Acetate from Canada ,just feel free to inquire